C12H12F2N4O2 — CID 95130185
1-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-3-(1H-pyrazol-4-yl)urea (PubChem CID 95130185) has the molecular formula C12H12F2N4O2 and a molecular weight of 282.25 g/mol. Its IUPAC name is 1-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-3-(1H-pyrazol-4-yl)urea.
| Compound Name | 1-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-3-(1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 95130185 |
| Molecular Formula | C12H12F2N4O2 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-3-(1H-pyrazol-4-yl)urea |
| SMILES | O=C(NC[C@H](O)c1ccc(F)c(F)c1)Nc1cn[nH]c1 |
| InChI | InChI=1S/C12H12F2N4O2/c13-9-2-1-7(3-10(9)14)11(19)6-15-12(20)18-8-4-16-17-5-8/h1-5,11,19H,6H2,(H,16,17)(H2,15,18,20)/t11-/m0/s1 |
| InChIKey | FXEXRRXRFFUHHX-NSHDSACASA-N |
| XLogP | 1.54 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |