C9H12BrNOS — CID 131134392
N-[(5-bromothiophen-3-yl)methyl]-2-methylpropanamide (PubChem CID 131134392) has the molecular formula C9H12BrNOS and a molecular weight of 262.17 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-2-methylpropanamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 131134392 |
| Molecular Formula | C9H12BrNOS |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCc1csc(Br)c1 |
| InChI | InChI=1S/C9H12BrNOS/c1-6(2)9(12)11-4-7-3-8(10)13-5-7/h3,5-6H,4H2,1-2H3,(H,11,12) |
| InChIKey | MQRIKLQXWZTKTJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |