C9H13BrN2OS — CID 103735729
(2R)-2-[(5-bromothiophen-3-yl)methylamino]-N-methylpropanamide (PubChem CID 103735729) has the molecular formula C9H13BrN2OS and a molecular weight of 277.19 g/mol. Its IUPAC name is (2R)-2-[(5-bromothiophen-3-yl)methylamino]-N-methylpropanamide.
| Compound Name | (2R)-2-[(5-bromothiophen-3-yl)methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 103735729 |
| Molecular Formula | C9H13BrN2OS |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | (2R)-2-[(5-bromothiophen-3-yl)methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)[C@@H](C)NCc1csc(Br)c1 |
| InChI | InChI=1S/C9H13BrN2OS/c1-6(9(13)11-2)12-4-7-3-8(10)14-5-7/h3,5-6,12H,4H2,1-2H3,(H,11,13)/t6-/m1/s1 |
| InChIKey | APRVZYMRDIHNBE-ZCFIWIBFSA-N |
| XLogP | 1.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |