C11H16BrN3O2S — CID 94025627
(2R)-N-[(5-bromothiophen-3-yl)methyl]-2-(carbamoylamino)-3-methylbutanamide (PubChem CID 94025627) has the molecular formula C11H16BrN3O2S and a molecular weight of 334.24 g/mol. Its IUPAC name is (2R)-N-[(5-bromothiophen-3-yl)methyl]-2-(carbamoylamino)-3-methylbutanamide.
| Compound Name | (2R)-N-[(5-bromothiophen-3-yl)methyl]-2-(carbamoylamino)-3-methylbutanamide |
|---|---|
| PubChem CID | 94025627 |
| Molecular Formula | C11H16BrN3O2S |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | (2R)-N-[(5-bromothiophen-3-yl)methyl]-2-(carbamoylamino)-3-methylbutanamide |
| SMILES | CC(C)[C@@H](NC(N)=O)C(=O)NCc1csc(Br)c1 |
| InChI | InChI=1S/C11H16BrN3O2S/c1-6(2)9(15-11(13)17)10(16)14-4-7-3-8(12)18-5-7/h3,5-6,9H,4H2,1-2H3,(H,14,16)(H3,13,15,17)/t9-/m1/s1 |
| InChIKey | BRHDVIMPHNTCAN-SECBINFHSA-N |
| XLogP | 1.82 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |