C17H24N4O3 — CID 42927190
N-[4-[[[2-(carbamoylamino)-3-methylbutanoyl]amino]methyl]phenyl]cyclopropanecarboxamide (PubChem CID 42927190) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-[4-[[[2-(carbamoylamino)-3-methylbutanoyl]amino]methyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[[2-(carbamoylamino)-3-methylbutanoyl]amino]methyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 42927190 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | N-[4-[[[2-(carbamoylamino)-3-methylbutanoyl]amino]methyl]phenyl]cyclopropanecarboxamide |
| SMILES | CC(C)C(NC(N)=O)C(=O)NCc1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C17H24N4O3/c1-10(2)14(21-17(18)24)16(23)19-9-11-3-7-13(8-4-11)20-15(22)12-5-6-12/h3-4,7-8,10,12,14H,5-6,9H2,1-2H3,(H,19,23)(H,20,22)(H3,18,21,24) |
| InChIKey | FJCDKQJRAYCVBW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |