C21H33N3O2 — CID 18137263
N-[1-[[4-(dimethylamino)phenyl]methylamino]-3-methyl-1-oxobutan-2-yl]cyclohexanecarboxamide (PubChem CID 18137263) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is N-[1-[[4-(dimethylamino)phenyl]methylamino]-3-methyl-1-oxobutan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-[[4-(dimethylamino)phenyl]methylamino]-3-methyl-1-oxobutan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 18137263 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | N-[1-[[4-(dimethylamino)phenyl]methylamino]-3-methyl-1-oxobutan-2-yl]cyclohexanecarboxamide |
| SMILES | CC(C)C(NC(=O)C1CCCCC1)C(=O)NCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H33N3O2/c1-15(2)19(23-20(25)17-8-6-5-7-9-17)21(26)22-14-16-10-12-18(13-11-16)24(3)4/h10-13,15,17,19H,5-9,14H2,1-4H3,(H,22,26)(H,23,25) |
| InChIKey | GJGSWQVCGWVBAN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|