C15H21N3O2 — CID 79023059
N-[4-[[[(2S)-2-aminobutanoyl]amino]methyl]phenyl]cyclopropanecarboxamide (PubChem CID 79023059) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[4-[[[(2S)-2-aminobutanoyl]amino]methyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[[(2S)-2-aminobutanoyl]amino]methyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 79023059 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-[4-[[[(2S)-2-aminobutanoyl]amino]methyl]phenyl]cyclopropanecarboxamide |
| SMILES | CC[C@H](N)C(=O)NCc1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C15H21N3O2/c1-2-13(16)15(20)17-9-10-3-7-12(8-4-10)18-14(19)11-5-6-11/h3-4,7-8,11,13H,2,5-6,9,16H2,1H3,(H,17,20)(H,18,19)/t13-/m0/s1 |
| InChIKey | ZZQDIQXPUIWZIC-ZDUSSCGKSA-N |
| XLogP | 1.39 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |