C10H13Br2NOS — CID 141389322
5-bromo-N-[(5-bromothiophen-3-yl)methyl]pentanamide (PubChem CID 141389322) has the molecular formula C10H13Br2NOS and a molecular weight of 355.10 g/mol. Its IUPAC name is 5-bromo-N-[(5-bromothiophen-3-yl)methyl]pentanamide.
| Compound Name | 5-bromo-N-[(5-bromothiophen-3-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 141389322 |
| Molecular Formula | C10H13Br2NOS |
| Molecular Weight | 355.10 g/mol |
| Exact Mass | 352.91 |
| IUPAC Name | 5-bromo-N-[(5-bromothiophen-3-yl)methyl]pentanamide |
| SMILES | O=C(CCCCBr)NCc1csc(Br)c1 |
| InChI | InChI=1S/C10H13Br2NOS/c11-4-2-1-3-10(14)13-6-8-5-9(12)15-7-8/h5,7H,1-4,6H2,(H,13,14) |
| InChIKey | VLRMAQGNJMAINN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.10 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|