C12H12BrN3O — CID 107233872
N-[[4-(bromomethyl)phenyl]methyl]-1H-pyrazole-4-carboxamide (PubChem CID 107233872) has the molecular formula C12H12BrN3O and a molecular weight of 294.15 g/mol. Its IUPAC name is N-[[4-(bromomethyl)phenyl]methyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[[4-(bromomethyl)phenyl]methyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 107233872 |
| Molecular Formula | C12H12BrN3O |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | N-[[4-(bromomethyl)phenyl]methyl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCc1ccc(CBr)cc1)c1cn[nH]c1 |
| InChI | InChI=1S/C12H12BrN3O/c13-5-9-1-3-10(4-2-9)6-14-12(17)11-7-15-16-8-11/h1-4,7-8H,5-6H2,(H,14,17)(H,15,16) |
| InChIKey | XIXXSBVBFJUIHC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|