C14H13ClN2O3S — CID 43096630
4-[[(6-methylpyridine-2-carbonyl)amino]methyl]benzenesulfonyl chloride (PubChem CID 43096630) has the molecular formula C14H13ClN2O3S and a molecular weight of 324.79 g/mol. Its IUPAC name is 4-[[(6-methylpyridine-2-carbonyl)amino]methyl]benzenesulfonyl chloride.
| Compound Name | 4-[[(6-methylpyridine-2-carbonyl)amino]methyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 43096630 |
| Molecular Formula | C14H13ClN2O3S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 4-[[(6-methylpyridine-2-carbonyl)amino]methyl]benzenesulfonyl chloride |
| SMILES | Cc1cccc(C(=O)NCc2ccc(S(=O)(=O)Cl)cc2)n1 |
| InChI | InChI=1S/C14H13ClN2O3S/c1-10-3-2-4-13(17-10)14(18)16-9-11-5-7-12(8-6-11)21(15,19)20/h2-8H,9H2,1H3,(H,16,18) |
| InChIKey | CALXOYSNHBOLEW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |