C14H20BrNO2S — CID 151876643
[4-(5-bromo-2-ethylsulfanylphenyl)-2-methylbutan-2-yl] carbamate (PubChem CID 151876643) has the molecular formula C14H20BrNO2S and a molecular weight of 346.29 g/mol. Its IUPAC name is [4-(5-bromo-2-ethylsulfanylphenyl)-2-methylbutan-2-yl] carbamate.
| Compound Name | [4-(5-bromo-2-ethylsulfanylphenyl)-2-methylbutan-2-yl] carbamate |
|---|---|
| PubChem CID | 151876643 |
| Molecular Formula | C14H20BrNO2S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | [4-(5-bromo-2-ethylsulfanylphenyl)-2-methylbutan-2-yl] carbamate |
| SMILES | CCSc1ccc(Br)cc1CCC(C)(C)OC(N)=O |
| InChI | InChI=1S/C14H20BrNO2S/c1-4-19-12-6-5-11(15)9-10(12)7-8-14(2,3)18-13(16)17/h5-6,9H,4,7-8H2,1-3H3,(H2,16,17) |
| InChIKey | SNVABBXBNAEALL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |