C15H21BrN2O3 — CID 174614423
[5-(4-bromo-N-ethylanilino)-2-methyl-5-oxopentan-2-yl] carbamate (PubChem CID 174614423) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is [5-(4-bromo-N-ethylanilino)-2-methyl-5-oxopentan-2-yl] carbamate.
| Compound Name | [5-(4-bromo-N-ethylanilino)-2-methyl-5-oxopentan-2-yl] carbamate |
|---|---|
| PubChem CID | 174614423 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | [5-(4-bromo-N-ethylanilino)-2-methyl-5-oxopentan-2-yl] carbamate |
| SMILES | CCN(C(=O)CCC(C)(C)OC(N)=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H21BrN2O3/c1-4-18(12-7-5-11(16)6-8-12)13(19)9-10-15(2,3)21-14(17)20/h5-8H,4,9-10H2,1-3H3,(H2,17,20) |
| InChIKey | UUICBOUAECBMOA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |