C12H17BrN2OS — CID 114231437
2-[4-bromo-2-[(propan-2-ylamino)methyl]phenyl]sulfanylacetamide (PubChem CID 114231437) has the molecular formula C12H17BrN2OS and a molecular weight of 317.25 g/mol. Its IUPAC name is 2-[4-bromo-2-[(propan-2-ylamino)methyl]phenyl]sulfanylacetamide.
| Compound Name | 2-[4-bromo-2-[(propan-2-ylamino)methyl]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 114231437 |
| Molecular Formula | C12H17BrN2OS |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-[4-bromo-2-[(propan-2-ylamino)methyl]phenyl]sulfanylacetamide |
| SMILES | CC(C)NCc1cc(Br)ccc1SCC(N)=O |
| InChI | InChI=1S/C12H17BrN2OS/c1-8(2)15-6-9-5-10(13)3-4-11(9)17-7-12(14)16/h3-5,8,15H,6-7H2,1-2H3,(H2,14,16) |
| InChIKey | ZBMFEXVOMWSANA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |