C14H20FNO2S — CID 63807861
ethyl 2-[4-fluoro-2-[(propan-2-ylamino)methyl]phenyl]sulfanylacetate (PubChem CID 63807861) has the molecular formula C14H20FNO2S and a molecular weight of 285.38 g/mol. Its IUPAC name is ethyl 2-[4-fluoro-2-[(propan-2-ylamino)methyl]phenyl]sulfanylacetate.
| Compound Name | ethyl 2-[4-fluoro-2-[(propan-2-ylamino)methyl]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 63807861 |
| Molecular Formula | C14H20FNO2S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | ethyl 2-[4-fluoro-2-[(propan-2-ylamino)methyl]phenyl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1ccc(F)cc1CNC(C)C |
| InChI | InChI=1S/C14H20FNO2S/c1-4-18-14(17)9-19-13-6-5-12(15)7-11(13)8-16-10(2)3/h5-7,10,16H,4,8-9H2,1-3H3 |
| InChIKey | DBAYJWBAYCYLDF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |