C15H22FNO2S — CID 116687775
tert-butyl 2-[2-(ethylaminomethyl)-4-fluorophenyl]sulfanylacetate (PubChem CID 116687775) has the molecular formula C15H22FNO2S and a molecular weight of 299.41 g/mol. Its IUPAC name is tert-butyl 2-[2-(ethylaminomethyl)-4-fluorophenyl]sulfanylacetate.
| Compound Name | tert-butyl 2-[2-(ethylaminomethyl)-4-fluorophenyl]sulfanylacetate |
|---|---|
| PubChem CID | 116687775 |
| Molecular Formula | C15H22FNO2S |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | tert-butyl 2-[2-(ethylaminomethyl)-4-fluorophenyl]sulfanylacetate |
| SMILES | CCNCc1cc(F)ccc1SCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22FNO2S/c1-5-17-9-11-8-12(16)6-7-13(11)20-10-14(18)19-15(2,3)4/h6-8,17H,5,9-10H2,1-4H3 |
| InChIKey | MWXPOSBZXADOMW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |