C13H17FO3S — CID 116687870
tert-butyl 2-[2-fluoro-4-(hydroxymethyl)phenyl]sulfanylacetate (PubChem CID 116687870) has the molecular formula C13H17FO3S and a molecular weight of 272.34 g/mol. Its IUPAC name is tert-butyl 2-[2-fluoro-4-(hydroxymethyl)phenyl]sulfanylacetate.
| Compound Name | tert-butyl 2-[2-fluoro-4-(hydroxymethyl)phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 116687870 |
| Molecular Formula | C13H17FO3S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | tert-butyl 2-[2-fluoro-4-(hydroxymethyl)phenyl]sulfanylacetate |
| SMILES | CC(C)(C)OC(=O)CSc1ccc(CO)cc1F |
| InChI | InChI=1S/C13H17FO3S/c1-13(2,3)17-12(16)8-18-11-5-4-9(7-15)6-10(11)14/h4-6,15H,7-8H2,1-3H3 |
| InChIKey | VWCCOGJTIUPJAT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |