C22H37NO2S — CID 161164676
3-[5-[4-(tert-butylsulfonylmethyl)cyclohexyl]pentyl]aniline (PubChem CID 161164676) has the molecular formula C22H37NO2S and a molecular weight of 379.61 g/mol. Its IUPAC name is 3-[5-[4-(tert-butylsulfonylmethyl)cyclohexyl]pentyl]aniline.
| Compound Name | 3-[5-[4-(tert-butylsulfonylmethyl)cyclohexyl]pentyl]aniline |
|---|---|
| PubChem CID | 161164676 |
| Molecular Formula | C22H37NO2S |
| Molecular Weight | 379.61 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 3-[5-[4-(tert-butylsulfonylmethyl)cyclohexyl]pentyl]aniline |
| SMILES | CC(C)(C)S(=O)(=O)CC1CCC(CCCCCc2cccc(N)c2)CC1 |
| InChI | InChI=1S/C22H37NO2S/c1-22(2,3)26(24,25)17-20-14-12-18(13-15-20)8-5-4-6-9-19-10-7-11-21(23)16-19/h7,10-11,16,18,20H,4-6,8-9,12-15,17,23H2,1-3H3 |
| InChIKey | JCUWWKVOPBUGEN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|