C25H42O4S — CID 157426322
1-[6-[4-(tert-butylsulfonylmethyl)cyclohexyl]hexyl]-2,3-dimethoxybenzene (PubChem CID 157426322) has the molecular formula C25H42O4S and a molecular weight of 438.67 g/mol. Its IUPAC name is 1-[6-[4-(tert-butylsulfonylmethyl)cyclohexyl]hexyl]-2,3-dimethoxybenzene.
| Compound Name | 1-[6-[4-(tert-butylsulfonylmethyl)cyclohexyl]hexyl]-2,3-dimethoxybenzene |
|---|---|
| PubChem CID | 157426322 |
| Molecular Formula | C25H42O4S |
| Molecular Weight | 438.67 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 1-[6-[4-(tert-butylsulfonylmethyl)cyclohexyl]hexyl]-2,3-dimethoxybenzene |
| SMILES | COc1cccc(CCCCCCC2CCC(CS(=O)(=O)C(C)(C)C)CC2)c1OC |
| InChI | InChI=1S/C25H42O4S/c1-25(2,3)30(26,27)19-21-17-15-20(16-18-21)11-8-6-7-9-12-22-13-10-14-23(28-4)24(22)29-5/h10,13-14,20-21H,6-9,11-12,15-19H2,1-5H3 |
| InChIKey | LXUMJLPTQNXSGL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|