C16H24O2 — CID 140989777
1-(2-cyclohexylethyl)-2,3-dimethoxybenzene (PubChem CID 140989777) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)-2,3-dimethoxybenzene.
| Compound Name | 1-(2-cyclohexylethyl)-2,3-dimethoxybenzene |
|---|---|
| PubChem CID | 140989777 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1-(2-cyclohexylethyl)-2,3-dimethoxybenzene |
| SMILES | COc1cccc(CCC2CCCCC2)c1OC |
| InChI | InChI=1S/C16H24O2/c1-17-15-10-6-9-14(16(15)18-2)12-11-13-7-4-3-5-8-13/h6,9-10,13H,3-5,7-8,11-12H2,1-2H3 |
| InChIKey | RJWNRHYXDMNMFA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |