C17H26O3 — CID 115838559
3-cyclohexyl-1-(2,6-dimethoxyphenyl)propan-1-ol (PubChem CID 115838559) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 3-cyclohexyl-1-(2,6-dimethoxyphenyl)propan-1-ol.
| Compound Name | 3-cyclohexyl-1-(2,6-dimethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 115838559 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 3-cyclohexyl-1-(2,6-dimethoxyphenyl)propan-1-ol |
| SMILES | COc1cccc(OC)c1C(O)CCC1CCCCC1 |
| InChI | InChI=1S/C17H26O3/c1-19-15-9-6-10-16(20-2)17(15)14(18)12-11-13-7-4-3-5-8-13/h6,9-10,13-14,18H,3-5,7-8,11-12H2,1-2H3 |
| InChIKey | PDAHUPFVEDREJJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |