C14H20O5S — CID 105131622
1-(2,6-dimethoxyphenyl)-2-(1,1-dioxothiolan-3-yl)ethanol (PubChem CID 105131622) has the molecular formula C14H20O5S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-2-(1,1-dioxothiolan-3-yl)ethanol.
| Compound Name | 1-(2,6-dimethoxyphenyl)-2-(1,1-dioxothiolan-3-yl)ethanol |
|---|---|
| PubChem CID | 105131622 |
| Molecular Formula | C14H20O5S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-2-(1,1-dioxothiolan-3-yl)ethanol |
| SMILES | COc1cccc(OC)c1C(O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H20O5S/c1-18-12-4-3-5-13(19-2)14(12)11(15)8-10-6-7-20(16,17)9-10/h3-5,10-11,15H,6-9H2,1-2H3 |
| InChIKey | SWOUCNWCOJJWIM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |