C15H22O3S — CID 105131014
2-(1,1-dioxothiolan-3-yl)-1-(3-propylphenyl)ethanol (PubChem CID 105131014) has the molecular formula C15H22O3S and a molecular weight of 282.41 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-1-(3-propylphenyl)ethanol.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-1-(3-propylphenyl)ethanol |
|---|---|
| PubChem CID | 105131014 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-1-(3-propylphenyl)ethanol |
| SMILES | CCCc1cccc(C(O)CC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H22O3S/c1-2-4-12-5-3-6-14(9-12)15(16)10-13-7-8-19(17,18)11-13/h3,5-6,9,13,15-16H,2,4,7-8,10-11H2,1H3 |
| InChIKey | SUPGBSKTJZUBTI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |