C15H17NO3S — CID 105118989
2-(1,1-dioxothiolan-3-yl)-1-quinolin-7-ylethanol (PubChem CID 105118989) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-1-quinolin-7-ylethanol.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-1-quinolin-7-ylethanol |
|---|---|
| PubChem CID | 105118989 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-1-quinolin-7-ylethanol |
| SMILES | O=S1(=O)CCC(CC(O)c2ccc3cccnc3c2)C1 |
| InChI | InChI=1S/C15H17NO3S/c17-15(8-11-5-7-20(18,19)10-11)13-4-3-12-2-1-6-16-14(12)9-13/h1-4,6,9,11,15,17H,5,7-8,10H2 |
| InChIKey | FMXAJNYJJQWEIM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |