C16H25NO2S — CID 105187986
2-(1,1-dioxothiolan-3-yl)-N-methyl-1-(3-propylphenyl)ethanamine (PubChem CID 105187986) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-methyl-1-(3-propylphenyl)ethanamine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-methyl-1-(3-propylphenyl)ethanamine |
|---|---|
| PubChem CID | 105187986 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-methyl-1-(3-propylphenyl)ethanamine |
| SMILES | CCCc1cccc(C(CC2CCS(=O)(=O)C2)NC)c1 |
| InChI | InChI=1S/C16H25NO2S/c1-3-5-13-6-4-7-15(10-13)16(17-2)11-14-8-9-20(18,19)12-14/h4,6-7,10,14,16-17H,3,5,8-9,11-12H2,1-2H3 |
| InChIKey | VUXPEMLMKMXRRY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |