C14H19BrO5S — CID 103524551
1-(3-bromo-2,4-dimethoxyphenyl)-2-(1,1-dioxothiolan-3-yl)ethanol (PubChem CID 103524551) has the molecular formula C14H19BrO5S and a molecular weight of 379.27 g/mol. Its IUPAC name is 1-(3-bromo-2,4-dimethoxyphenyl)-2-(1,1-dioxothiolan-3-yl)ethanol.
| Compound Name | 1-(3-bromo-2,4-dimethoxyphenyl)-2-(1,1-dioxothiolan-3-yl)ethanol |
|---|---|
| PubChem CID | 103524551 |
| Molecular Formula | C14H19BrO5S |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 1-(3-bromo-2,4-dimethoxyphenyl)-2-(1,1-dioxothiolan-3-yl)ethanol |
| SMILES | COc1ccc(C(O)CC2CCS(=O)(=O)C2)c(OC)c1Br |
| InChI | InChI=1S/C14H19BrO5S/c1-19-12-4-3-10(14(20-2)13(12)15)11(16)7-9-5-6-21(17,18)8-9/h3-4,9,11,16H,5-8H2,1-2H3 |
| InChIKey | PAVODJZIHWTZSL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |