C13H19BrO4 — CID 103523197
1-(3-bromo-2,4-dimethoxyphenyl)-4-methoxybutan-1-ol (PubChem CID 103523197) has the molecular formula C13H19BrO4 and a molecular weight of 319.20 g/mol. Its IUPAC name is 1-(3-bromo-2,4-dimethoxyphenyl)-4-methoxybutan-1-ol.
| Compound Name | 1-(3-bromo-2,4-dimethoxyphenyl)-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 103523197 |
| Molecular Formula | C13H19BrO4 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1-(3-bromo-2,4-dimethoxyphenyl)-4-methoxybutan-1-ol |
| SMILES | COCCCC(O)c1ccc(OC)c(Br)c1OC |
| InChI | InChI=1S/C13H19BrO4/c1-16-8-4-5-10(15)9-6-7-11(17-2)12(14)13(9)18-3/h6-7,10,15H,4-5,8H2,1-3H3 |
| InChIKey | FEMMYGMXLDIHDK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|