C15H13Br3O3 — CID 107978790
(3-bromo-2,4-dimethoxyphenyl)-(3,5-dibromophenyl)methanol (PubChem CID 107978790) has the molecular formula C15H13Br3O3 and a molecular weight of 480.98 g/mol. Its IUPAC name is (3-bromo-2,4-dimethoxyphenyl)-(3,5-dibromophenyl)methanol.
| Compound Name | (3-bromo-2,4-dimethoxyphenyl)-(3,5-dibromophenyl)methanol |
|---|---|
| PubChem CID | 107978790 |
| Molecular Formula | C15H13Br3O3 |
| Molecular Weight | 480.98 g/mol |
| Exact Mass | 477.84 |
| IUPAC Name | (3-bromo-2,4-dimethoxyphenyl)-(3,5-dibromophenyl)methanol |
| SMILES | COc1ccc(C(O)c2cc(Br)cc(Br)c2)c(OC)c1Br |
| InChI | InChI=1S/C15H13Br3O3/c1-20-12-4-3-11(15(21-2)13(12)18)14(19)8-5-9(16)7-10(17)6-8/h3-7,14,19H,1-2H3 |
| InChIKey | PESBYYWNEWMCSA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.98 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |