C12H15BrO5 — CID 114207364
(4S)-4-(3-bromo-2,4-dimethoxyphenyl)-4-hydroxybutanoic acid (PubChem CID 114207364) has the molecular formula C12H15BrO5 and a molecular weight of 319.15 g/mol. Its IUPAC name is (4S)-4-(3-bromo-2,4-dimethoxyphenyl)-4-hydroxybutanoic acid.
| Compound Name | (4S)-4-(3-bromo-2,4-dimethoxyphenyl)-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 114207364 |
| Molecular Formula | C12H15BrO5 |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | (4S)-4-(3-bromo-2,4-dimethoxyphenyl)-4-hydroxybutanoic acid |
| SMILES | COc1ccc([C@@H](O)CCC(=O)O)c(OC)c1Br |
| InChI | InChI=1S/C12H15BrO5/c1-17-9-5-3-7(12(18-2)11(9)13)8(14)4-6-10(15)16/h3,5,8,14H,4,6H2,1-2H3,(H,15,16)/t8-/m0/s1 |
| InChIKey | DCDKRYTUWLRJFK-QMMMGPOBSA-N |
| XLogP | 2.36 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |