C19H24O7 — CID 10570762
(2,3,4-trimethoxyphenyl)-(3,4,5-trimethoxyphenyl)methanol (PubChem CID 10570762) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is (2,3,4-trimethoxyphenyl)-(3,4,5-trimethoxyphenyl)methanol.
| Compound Name | (2,3,4-trimethoxyphenyl)-(3,4,5-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 10570762 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (2,3,4-trimethoxyphenyl)-(3,4,5-trimethoxyphenyl)methanol |
| SMILES | COc1cc(C(O)c2ccc(OC)c(OC)c2OC)cc(OC)c1OC |
| InChI | InChI=1S/C19H24O7/c1-21-13-8-7-12(17(24-4)19(13)26-6)16(20)11-9-14(22-2)18(25-5)15(10-11)23-3/h7-10,16,20H,1-6H3 |
| InChIKey | IERYQJAQKXHDEJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |