C15H13ClF2O3 — CID 62800710
(3-chloro-4,5-dimethoxyphenyl)-(2,4-difluorophenyl)methanol (PubChem CID 62800710) has the molecular formula C15H13ClF2O3 and a molecular weight of 314.72 g/mol. Its IUPAC name is (3-chloro-4,5-dimethoxyphenyl)-(2,4-difluorophenyl)methanol.
| Compound Name | (3-chloro-4,5-dimethoxyphenyl)-(2,4-difluorophenyl)methanol |
|---|---|
| PubChem CID | 62800710 |
| Molecular Formula | C15H13ClF2O3 |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | (3-chloro-4,5-dimethoxyphenyl)-(2,4-difluorophenyl)methanol |
| SMILES | COc1cc(C(O)c2ccc(F)cc2F)cc(Cl)c1OC |
| InChI | InChI=1S/C15H13ClF2O3/c1-20-13-6-8(5-11(16)15(13)21-2)14(19)10-4-3-9(17)7-12(10)18/h3-7,14,19H,1-2H3 |
| InChIKey | YLGKGJFZJMCQBE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |