C13H13ClO4 — CID 63947956
(3-chloro-4,5-dimethoxyphenyl)-(furan-2-yl)methanol (PubChem CID 63947956) has the molecular formula C13H13ClO4 and a molecular weight of 268.70 g/mol. Its IUPAC name is (3-chloro-4,5-dimethoxyphenyl)-(furan-2-yl)methanol.
| Compound Name | (3-chloro-4,5-dimethoxyphenyl)-(furan-2-yl)methanol |
|---|---|
| PubChem CID | 63947956 |
| Molecular Formula | C13H13ClO4 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | (3-chloro-4,5-dimethoxyphenyl)-(furan-2-yl)methanol |
| SMILES | COc1cc(C(O)c2ccco2)cc(Cl)c1OC |
| InChI | InChI=1S/C13H13ClO4/c1-16-11-7-8(6-9(14)13(11)17-2)12(15)10-4-3-5-18-10/h3-7,12,15H,1-2H3 |
| InChIKey | PXTHZBSELJZFLD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |