C14H16ClNO4 — CID 60897326
2-(5-chloro-2,4-dimethoxyanilino)-1-(furan-2-yl)ethanol (PubChem CID 60897326) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is 2-(5-chloro-2,4-dimethoxyanilino)-1-(furan-2-yl)ethanol.
| Compound Name | 2-(5-chloro-2,4-dimethoxyanilino)-1-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 60897326 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-(5-chloro-2,4-dimethoxyanilino)-1-(furan-2-yl)ethanol |
| SMILES | COc1cc(OC)c(NCC(O)c2ccco2)cc1Cl |
| InChI | InChI=1S/C14H16ClNO4/c1-18-13-7-14(19-2)10(6-9(13)15)16-8-11(17)12-4-3-5-20-12/h3-7,11,16-17H,8H2,1-2H3 |
| InChIKey | BXUAALZPBVLNHR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|