C14H22ClNO2 — CID 43095051
5-chloro-2,4-dimethoxy-N-(2-methylpentyl)aniline (PubChem CID 43095051) has the molecular formula C14H22ClNO2 and a molecular weight of 271.79 g/mol. Its IUPAC name is 5-chloro-2,4-dimethoxy-N-(2-methylpentyl)aniline.
| Compound Name | 5-chloro-2,4-dimethoxy-N-(2-methylpentyl)aniline |
|---|---|
| PubChem CID | 43095051 |
| Molecular Formula | C14H22ClNO2 |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 5-chloro-2,4-dimethoxy-N-(2-methylpentyl)aniline |
| SMILES | CCCC(C)CNc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C14H22ClNO2/c1-5-6-10(2)9-16-12-7-11(15)13(17-3)8-14(12)18-4/h7-8,10,16H,5-6,9H2,1-4H3 |
| InChIKey | PLSBSPKQGGEMAN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|