C14H23ClN2O2 — CID 28576071
N-(5-chloro-2,4-dimethoxyphenyl)-N',N'-diethylethane-1,2-diamine (PubChem CID 28576071) has the molecular formula C14H23ClN2O2 and a molecular weight of 286.80 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 28576071 |
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C14H23ClN2O2/c1-5-17(6-2)8-7-16-12-9-11(15)13(18-3)10-14(12)19-4/h9-10,16H,5-8H2,1-4H3 |
| InChIKey | ISNXTFZHXIBDPL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|