C9H10Cl3NO — CID 115214609
2,5-dichloro-N-(2-chloroethyl)-4-methoxyaniline (PubChem CID 115214609) has the molecular formula C9H10Cl3NO and a molecular weight of 254.54 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-chloroethyl)-4-methoxyaniline.
| Compound Name | 2,5-dichloro-N-(2-chloroethyl)-4-methoxyaniline |
|---|---|
| PubChem CID | 115214609 |
| Molecular Formula | C9H10Cl3NO |
| Molecular Weight | 254.54 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | 2,5-dichloro-N-(2-chloroethyl)-4-methoxyaniline |
| SMILES | COc1cc(Cl)c(NCCCl)cc1Cl |
| InChI | InChI=1S/C9H10Cl3NO/c1-14-9-5-6(11)8(4-7(9)12)13-3-2-10/h4-5,13H,2-3H2,1H3 |
| InChIKey | MZPKGXDQISVCHV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|