C12H19ClN2O — CID 115197672
N'-(5-chloro-4-methoxy-2-methylphenyl)-N-methylpropane-1,3-diamine (PubChem CID 115197672) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is N'-(5-chloro-4-methoxy-2-methylphenyl)-N-methylpropane-1,3-diamine.
| Compound Name | N'-(5-chloro-4-methoxy-2-methylphenyl)-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115197672 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N'-(5-chloro-4-methoxy-2-methylphenyl)-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNc1cc(Cl)c(OC)cc1C |
| InChI | InChI=1S/C12H19ClN2O/c1-9-7-12(16-3)10(13)8-11(9)15-6-4-5-14-2/h7-8,14-15H,4-6H2,1-3H3 |
| InChIKey | BFANOHZAWMECAB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|