C13H22N2O3 — CID 115197735
N-methyl-N'-(2,4,5-trimethoxyphenyl)propane-1,3-diamine (PubChem CID 115197735) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is N-methyl-N'-(2,4,5-trimethoxyphenyl)propane-1,3-diamine.
| Compound Name | N-methyl-N'-(2,4,5-trimethoxyphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 115197735 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N-methyl-N'-(2,4,5-trimethoxyphenyl)propane-1,3-diamine |
| SMILES | CNCCCNc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C13H22N2O3/c1-14-6-5-7-15-10-8-12(17-3)13(18-4)9-11(10)16-2/h8-9,14-15H,5-7H2,1-4H3 |
| InChIKey | UQZQENZMMCSBMD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|