C12H20N2O3 — CID 115196333
1-N-(2,4,5-trimethoxyphenyl)propane-1,2-diamine (PubChem CID 115196333) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 1-N-(2,4,5-trimethoxyphenyl)propane-1,2-diamine.
| Compound Name | 1-N-(2,4,5-trimethoxyphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 115196333 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-N-(2,4,5-trimethoxyphenyl)propane-1,2-diamine |
| SMILES | COc1cc(OC)c(OC)cc1NCC(C)N |
| InChI | InChI=1S/C12H20N2O3/c1-8(13)7-14-9-5-11(16-3)12(17-4)6-10(9)15-2/h5-6,8,14H,7,13H2,1-4H3 |
| InChIKey | BXYKAVYGULJILM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|