C12H20N2O — CID 115196260
1-N-(4-methoxy-2,5-dimethylphenyl)propane-1,2-diamine (PubChem CID 115196260) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-N-(4-methoxy-2,5-dimethylphenyl)propane-1,2-diamine.
| Compound Name | 1-N-(4-methoxy-2,5-dimethylphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 115196260 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-N-(4-methoxy-2,5-dimethylphenyl)propane-1,2-diamine |
| SMILES | COc1cc(C)c(NCC(C)N)cc1C |
| InChI | InChI=1S/C12H20N2O/c1-8-6-12(15-4)9(2)5-11(8)14-7-10(3)13/h5-6,10,14H,7,13H2,1-4H3 |
| InChIKey | FLEYAVSQNGFNRI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|