C12H21N3O — CID 115119373
3-N-(4-methoxy-2,5-dimethylphenyl)propane-1,2,3-triamine (PubChem CID 115119373) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-N-(4-methoxy-2,5-dimethylphenyl)propane-1,2,3-triamine.
| Compound Name | 3-N-(4-methoxy-2,5-dimethylphenyl)propane-1,2,3-triamine |
|---|---|
| PubChem CID | 115119373 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 3-N-(4-methoxy-2,5-dimethylphenyl)propane-1,2,3-triamine |
| SMILES | COc1cc(C)c(NCC(N)CN)cc1C |
| InChI | InChI=1S/C12H21N3O/c1-8-5-12(16-3)9(2)4-11(8)15-7-10(14)6-13/h4-5,10,15H,6-7,13-14H2,1-3H3 |
| InChIKey | NOYAUZVAFHSJNN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|