C12H21N3 — CID 115119407
3-N-(2,4,5-trimethylphenyl)propane-1,2,3-triamine (PubChem CID 115119407) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-N-(2,4,5-trimethylphenyl)propane-1,2,3-triamine.
| Compound Name | 3-N-(2,4,5-trimethylphenyl)propane-1,2,3-triamine |
|---|---|
| PubChem CID | 115119407 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 3-N-(2,4,5-trimethylphenyl)propane-1,2,3-triamine |
| SMILES | Cc1cc(C)c(NCC(N)CN)cc1C |
| InChI | InChI=1S/C12H21N3/c1-8-4-10(3)12(5-9(8)2)15-7-11(14)6-13/h4-5,11,15H,6-7,13-14H2,1-3H3 |
| InChIKey | ZHZAYAASFLROQS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |