C14H24N2 — CID 115202328
2-methyl-N-(2,4,5-trimethylphenyl)butane-1,4-diamine (PubChem CID 115202328) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-methyl-N-(2,4,5-trimethylphenyl)butane-1,4-diamine.
| Compound Name | 2-methyl-N-(2,4,5-trimethylphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 115202328 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 2-methyl-N-(2,4,5-trimethylphenyl)butane-1,4-diamine |
| SMILES | Cc1cc(C)c(NCC(C)CCN)cc1C |
| InChI | InChI=1S/C14H24N2/c1-10(5-6-15)9-16-14-8-12(3)11(2)7-13(14)4/h7-8,10,16H,5-6,9,15H2,1-4H3 |
| InChIKey | BJRQTOXPTFSLOU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |