C9H13F2N3 — CID 115119393
3-N-(2,4-difluorophenyl)propane-1,2,3-triamine (PubChem CID 115119393) has the molecular formula C9H13F2N3 and a molecular weight of 201.22 g/mol. Its IUPAC name is 3-N-(2,4-difluorophenyl)propane-1,2,3-triamine.
| Compound Name | 3-N-(2,4-difluorophenyl)propane-1,2,3-triamine |
|---|---|
| PubChem CID | 115119393 |
| Molecular Formula | C9H13F2N3 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 3-N-(2,4-difluorophenyl)propane-1,2,3-triamine |
| SMILES | NCC(N)CNc1ccc(F)cc1F |
| InChI | InChI=1S/C9H13F2N3/c10-6-1-2-9(8(11)3-6)14-5-7(13)4-12/h1-3,7,14H,4-5,12-13H2 |
| InChIKey | ZENJRERWAFTLLA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |