C12H20N2O2 — CID 103388458
2-N-(4,5-dimethoxy-2-methylphenyl)propane-1,2-diamine (PubChem CID 103388458) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-N-(4,5-dimethoxy-2-methylphenyl)propane-1,2-diamine.
| Compound Name | 2-N-(4,5-dimethoxy-2-methylphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 103388458 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-N-(4,5-dimethoxy-2-methylphenyl)propane-1,2-diamine |
| SMILES | COc1cc(C)c(NC(C)CN)cc1OC |
| InChI | InChI=1S/C12H20N2O2/c1-8-5-11(15-3)12(16-4)6-10(8)14-9(2)7-13/h5-6,9,14H,7,13H2,1-4H3 |
| InChIKey | LNLAEIIRERLIIT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|