C13H21NO3 — CID 55086474
4,5-dimethoxy-N-(1-methoxypropan-2-yl)-2-methylaniline (PubChem CID 55086474) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 4,5-dimethoxy-N-(1-methoxypropan-2-yl)-2-methylaniline.
| Compound Name | 4,5-dimethoxy-N-(1-methoxypropan-2-yl)-2-methylaniline |
|---|---|
| PubChem CID | 55086474 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4,5-dimethoxy-N-(1-methoxypropan-2-yl)-2-methylaniline |
| SMILES | COCC(C)Nc1cc(OC)c(OC)cc1C |
| InChI | InChI=1S/C13H21NO3/c1-9-6-12(16-4)13(17-5)7-11(9)14-10(2)8-15-3/h6-7,10,14H,8H2,1-5H3 |
| InChIKey | VWIBAWDAAREGMN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|