C14H22N2O3 — CID 9044402
(2S)-2-(4,5-dimethoxy-2-methylanilino)-N-ethylpropanamide (PubChem CID 9044402) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2S)-2-(4,5-dimethoxy-2-methylanilino)-N-ethylpropanamide.
| Compound Name | (2S)-2-(4,5-dimethoxy-2-methylanilino)-N-ethylpropanamide |
|---|---|
| PubChem CID | 9044402 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (2S)-2-(4,5-dimethoxy-2-methylanilino)-N-ethylpropanamide |
| SMILES | CCNC(=O)[C@H](C)Nc1cc(OC)c(OC)cc1C |
| InChI | InChI=1S/C14H22N2O3/c1-6-15-14(17)10(3)16-11-8-13(19-5)12(18-4)7-9(11)2/h7-8,10,16H,6H2,1-5H3,(H,15,17)/t10-/m0/s1 |
| InChIKey | CQAHGYSIPBSMPQ-JTQLQIEISA-N |
| XLogP | 1.95 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|