C19H30N2O3 — CID 11924075
(2S)-2-(4,5-dimethoxy-2-methylanilino)-N-[(1R,2S)-2-methylcyclohexyl]propanamide (PubChem CID 11924075) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is (2S)-2-(4,5-dimethoxy-2-methylanilino)-N-[(1R,2S)-2-methylcyclohexyl]propanamide.
| Compound Name | (2S)-2-(4,5-dimethoxy-2-methylanilino)-N-[(1R,2S)-2-methylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 11924075 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (2S)-2-(4,5-dimethoxy-2-methylanilino)-N-[(1R,2S)-2-methylcyclohexyl]propanamide |
| SMILES | COc1cc(C)c(N[C@@H](C)C(=O)N[C@@H]2CCCC[C@@H]2C)cc1OC |
| InChI | InChI=1S/C19H30N2O3/c1-12-8-6-7-9-15(12)21-19(22)14(3)20-16-11-18(24-5)17(23-4)10-13(16)2/h10-12,14-15,20H,6-9H2,1-5H3,(H,21,22)/t12-,14-,15+/m0/s1 |
| InChIKey | SIVGZBSUEVQUJX-AEGPPILISA-N |
| XLogP | 3.51 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|