C18H23N3O5S — CID 47005946
2-(4,5-dimethoxy-2-methylanilino)-N-(4-sulfamoylphenyl)propanamide (PubChem CID 47005946) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-methylanilino)-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 2-(4,5-dimethoxy-2-methylanilino)-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 47005946 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-(4,5-dimethoxy-2-methylanilino)-N-(4-sulfamoylphenyl)propanamide |
| SMILES | COc1cc(C)c(NC(C)C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C18H23N3O5S/c1-11-9-16(25-3)17(26-4)10-15(11)20-12(2)18(22)21-13-5-7-14(8-6-13)27(19,23)24/h5-10,12,20H,1-4H3,(H,21,22)(H2,19,23,24) |
| InChIKey | QSRFSPGSDHEDGP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|