C17H20ClN3O5S — CID 4787331
2-(5-chloro-2,4-dimethoxyanilino)-N-(4-sulfamoylphenyl)propanamide (PubChem CID 4787331) has the molecular formula C17H20ClN3O5S and a molecular weight of 413.88 g/mol. Its IUPAC name is 2-(5-chloro-2,4-dimethoxyanilino)-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 2-(5-chloro-2,4-dimethoxyanilino)-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 4787331 |
| Molecular Formula | C17H20ClN3O5S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 2-(5-chloro-2,4-dimethoxyanilino)-N-(4-sulfamoylphenyl)propanamide |
| SMILES | COc1cc(OC)c(NC(C)C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1Cl |
| InChI | InChI=1S/C17H20ClN3O5S/c1-10(20-14-8-13(18)15(25-2)9-16(14)26-3)17(22)21-11-4-6-12(7-5-11)27(19,23)24/h4-10,20H,1-3H3,(H,21,22)(H2,19,23,24) |
| InChIKey | VZGYNUKDZLAHTI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|