C18H21ClN2O4 — CID 35960377
(2S)-2-(5-chloro-2,4-dimethoxyanilino)-N-(4-methoxyphenyl)propanamide (PubChem CID 35960377) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is (2S)-2-(5-chloro-2,4-dimethoxyanilino)-N-(4-methoxyphenyl)propanamide.
| Compound Name | (2S)-2-(5-chloro-2,4-dimethoxyanilino)-N-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 35960377 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (2S)-2-(5-chloro-2,4-dimethoxyanilino)-N-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)[C@H](C)Nc2cc(Cl)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C18H21ClN2O4/c1-11(18(22)21-12-5-7-13(23-2)8-6-12)20-15-9-14(19)16(24-3)10-17(15)25-4/h5-11,20H,1-4H3,(H,21,22)/t11-/m0/s1 |
| InChIKey | YNNYPPZGOQFAKM-NSHDSACASA-N |
| XLogP | 3.80 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|